cas: 1031747-36-0 — see every product listed under this CAS number, including other names
4-(N-Cyclopropylaminocarbonyl)methylphenylboronic acid, pinacol ester, 96%, 96% (CAS 1031747-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SUO-100mg |
| cas | 1031747-36-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1864.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1031747-36-0) is a chemical compound with the molecular formula C17H24BNO3 and a molecular weight of 301.2 g/mol. IUPAC name: N-cyclopropyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: OMUSBQSFTZGDAM-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO3 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-cyclopropyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | OMUSBQSFTZGDAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)NC3CC3 |
Computed by PubChem (NCBI)