cas: 949115-03-1 — see every product listed under this CAS number, including other names
4-(Phenylaminocarbonyl)benzeneboronic acid pinacol ester, 97%+(GC-MS),RG, 97%+(GC-MS),RG (CAS 949115-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIND-100mg |
| cas | 949115-03-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 726.80 Pln | |
| Chemat | 25g | 2723.60 Pln |
| purity | 97%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 949115-03-1) is a chemical compound with the molecular formula C19H22BNO3 and a molecular weight of 323.2 g/mol. IUPAC name: N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: TWLVUSQQVDJZPI-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO3 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | TWLVUSQQVDJZPI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)