CAS 25739-23-5 appears in our catalog under these names: 4–(Phenylethynyl)benzoic acid, 4-(Phenylethynyl)benzoic acid, 98%, 98%, 4-Phenylethynyl-benzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
4-(2-phenylethynyl)benzoic acid (CAS 25739-23-5) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(2-phenylethynyl)benzoic acid. InChIKey: OGZUGPOTBGMCLE-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-(2-phenylethynyl)benzoic acid |
| InChIKey | OGZUGPOTBGMCLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)