cas: 330792-87-5 — see every product listed under this CAS number, including other names
4-(Pyrimidin-2-yloxy)phenylboronic acid pinacol ester 98% (CAS 330792-87-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A957640-50mg |
| cas | 330792-87-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 515.00 Pln | |
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 1221.44 Pln | |
| Ambeed | 1g | 2428.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A957640 |
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrimidine (CAS 330792-87-5) is a chemical compound with the molecular formula C16H19BN2O3 and a molecular weight of 298.1 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrimidine. InChIKey: ZPEICWIOBDONIG-UHFFFAOYSA-N.
| Molecular formula | C16H19BN2O3 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrimidine |
| InChIKey | ZPEICWIOBDONIG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=NC=CC=N3 |
Computed by PubChem (NCBI)