cas: 102245-65-8 — see every product listed under this CAS number, including other names
4-(TERT-BUTYLDIMETHYLSILYLOXY)-2-BUTYNOIC ACID, 97% (CAS 102245-65-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333889-100MG |
| cas | 102245-65-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3876.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoic acid (CAS 102245-65-8) is a chemical compound with the molecular formula C10H18O3Si and a molecular weight of 214.33 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoic acid. InChIKey: DNEAINNTXMYDFB-UHFFFAOYSA-N.
| Molecular formula | C10H18O3Si |
|---|---|
| Molecular weight | 214.33 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxybut-2-ynoic acid |
| InChIKey | DNEAINNTXMYDFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(=O)O |
Computed by PubChem (NCBI)