cas: 1147530-76-4 — see every product listed under this CAS number, including other names
4-(Tert-butyl)-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide, 95%, 95% (CAS 1147530-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNNO-250mg |
| cas | 1147530-76-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 3851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-tert-butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 1147530-76-4) is a chemical compound with the molecular formula C23H30BNO3 and a molecular weight of 379.3 g/mol. IUPAC name: 4-tert-butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: XZLWJBORFAPQRA-UHFFFAOYSA-N.
| Molecular formula | C23H30BNO3 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 4-tert-butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | XZLWJBORFAPQRA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)