cas: 107834-03-7 — see every product listed under this CAS number, including other names
4-(Thiophen-2-yl)benzaldehyde 98% (CAS 107834-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A224963-100mg |
| cas | 107834-03-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1460.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A224963 |
4-thiophen-2-ylbenzaldehyde (CAS 107834-03-7) is a chemical compound with the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. IUPAC name: 4-thiophen-2-ylbenzaldehyde. InChIKey: UECDQUOWFRTJOH-UHFFFAOYSA-N.
| Molecular formula | C11H8OS |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 4-thiophen-2-ylbenzaldehyde |
| InChIKey | UECDQUOWFRTJOH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)