4-(Thiophen-2-yl)benzaldehyde, 98%
cas: 107834-03-7 — see every product listed under this CAS number, including other names
4-(Thiophen-2-yl)benzaldehyde, 98% (CAS 107834-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A224963-100mg |
| cas | 107834-03-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1471.75 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 755.60 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1580.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-thiophen-2-ylbenzaldehyde (CAS 107834-03-7) is a chemical compound with the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. IUPAC name: 4-thiophen-2-ylbenzaldehyde. InChIKey: UECDQUOWFRTJOH-UHFFFAOYSA-N.
| Molecular formula | C11H8OS |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 4-thiophen-2-ylbenzaldehyde |
| InChIKey | UECDQUOWFRTJOH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)
