cas: 2089378-62-9 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97% (CAS 2089378-62-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU7G-100mg |
| cas | 2089378-62-9 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 818.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2089378-62-9) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 4-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: XVVOVEJDWGMYRJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 4-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | XVVOVEJDWGMYRJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC=C2OC(F)(F)F.Cl |
Computed by PubChem (NCBI)