cas: 104678-68-4 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)-3-(trifluoromethyl)aniline 98% (CAS 104678-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816827-100mg |
| cas | 104678-68-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Ambeed | 5g | 4781.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A816827 |
4-(trifluoromethoxy)-3-(trifluoromethyl)aniline (CAS 104678-68-4) is a chemical compound with the molecular formula C8H5F6NO and a molecular weight of 245.12 g/mol. IUPAC name: 4-(trifluoromethoxy)-3-(trifluoromethyl)aniline. InChIKey: ZXYQQLFHWWMQHL-UHFFFAOYSA-N.
| Molecular formula | C8H5F6NO |
|---|---|
| Molecular weight | 245.12 g/mol |
| IUPAC name | 4-(trifluoromethoxy)-3-(trifluoromethyl)aniline |
| InChIKey | ZXYQQLFHWWMQHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)OC(F)(F)F |
Computed by PubChem (NCBI)