cas: 456-71-3 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)benzamide, 97%, 97% (CAS 456-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 25g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KAW-100mg |
| cas | 456-71-3 |
| size | 100mg |
| availability | 28g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 10g | 362.00 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethoxy)benzamide (CAS 456-71-3) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4-(trifluoromethoxy)benzamide. InChIKey: IDIXWLCRJFBQJA-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzamide |
| InChIKey | IDIXWLCRJFBQJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)OC(F)(F)F |
Computed by PubChem (NCBI)