cas: 52201-01-1 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzene-1-sulfonyl fluoride 95% (CAS 52201-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1072612-100mg |
| cas | 52201-01-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1121.31 Pln | |
| Ambeed | 5g | 3173.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1072612 |
4-(trifluoromethyl)benzenesulfonyl fluoride (CAS 52201-01-1) is a chemical compound with the molecular formula C7H4F4O2S and a molecular weight of 228.17 g/mol. IUPAC name: 4-(trifluoromethyl)benzenesulfonyl fluoride. InChIKey: XSYRFOBVQLQWCO-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2S |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzenesulfonyl fluoride |
| InChIKey | XSYRFOBVQLQWCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)(=O)F |
Computed by PubChem (NCBI)