cas: 75867-39-9 — see every product listed under this CAS number, including other names
4-(Trimethylsilylethynyl)aniline, 98% (CAS 75867-39-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F064742-1G |
| cas | 75867-39-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 10g | 1008.00 Pln | |
| Fluorochem | 25g | 2049.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(2-trimethylsilylethynyl)aniline (CAS 75867-39-9) is a chemical compound with the molecular formula C11H15NSi and a molecular weight of 189.33 g/mol. IUPAC name: 4-(2-trimethylsilylethynyl)aniline. InChIKey: CHTZIDLXGXGNMA-UHFFFAOYSA-N.
| Molecular formula | C11H15NSi |
|---|---|
| Molecular weight | 189.33 g/mol |
| IUPAC name | 4-(2-trimethylsilylethynyl)aniline |
| InChIKey | CHTZIDLXGXGNMA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)