4-(tert-Butyl)-2-iodophenol, 97%
cas: 38941-98-9 — see every product listed under this CAS number, including other names
4-(tert-Butyl)-2-iodophenol, 97% (CAS 38941-98-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A139872-250mg |
| cas | 38941-98-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 1761.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 467.60 Pln | |
| Chemat | 25g | 966.80 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 553.16 Pln | |
| BLDpharm | 25g | 1897.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-tert-butyl-2-iodophenol (CAS 38941-98-9) is a chemical compound with the molecular formula C10H13IO and a molecular weight of 276.11 g/mol. IUPAC name: 4-tert-butyl-2-iodophenol. InChIKey: DTNQNHHVSJPDSG-UHFFFAOYSA-N.
| Molecular formula | C10H13IO |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 4-tert-butyl-2-iodophenol |
| InChIKey | DTNQNHHVSJPDSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)I |
Computed by PubChem (NCBI)