cas: 120743-99-9 — see every product listed under this CAS number, including other names
4-[(tert-Butyldimethylsilyl)oxy]benzaldehyde, 96% (CAS 120743-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635426-250MG |
| cas | 120743-99-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 1924.34 Pln | |
| Fluorochem | 25g | 3777.85 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde (CAS 120743-99-9) is a chemical compound with the molecular formula C13H20O2Si and a molecular weight of 236.38 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde. InChIKey: XACWSBWCLJXKGI-UHFFFAOYSA-N.
| Molecular formula | C13H20O2Si |
|---|---|
| Molecular weight | 236.38 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde |
| InChIKey | XACWSBWCLJXKGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)