cas: 3627-01-8 — see every product listed under this CAS number, including other names
4-[2-(2,4-Dihydroxyphenyl)diazenyl]-5-hydroxy-2,7-naphthalenedisulfonic acid, >97.0%(HPLC), >97.0%(HPLC) (CAS 3627-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CY78-100mg |
| cas | 3627-01-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 500mg | 458.00 Pln | |
| Chemat | 1g | 530.00 Pln |
| purity | >97.0%(HPLC) |
|---|---|
| delivery time | 3 weeks |
4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (CAS 3627-01-8) is a chemical compound with the molecular formula C16H12N2O9S2 and a molecular weight of 440.4 g/mol. IUPAC name: 4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid. InChIKey: BTEWRTUJKSQHIE-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O9S2 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 4-[(2,4-dihydroxyphenyl)diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| InChIKey | BTEWRTUJKSQHIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)N=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)O |
Computed by PubChem (NCBI)