cas: 1191063-31-6 — see every product listed under this CAS number, including other names
4-[2-(N-BOC-N-METHYLAMINO)ETHYL]PHENYLBORONIC ACID PINACOL ESTER, 96%, 96% (CAS 1191063-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HEXM-100mg |
| cas | 1191063-31-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1134.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate (CAS 1191063-31-6) is a chemical compound with the molecular formula C20H32BNO4 and a molecular weight of 361.3 g/mol. IUPAC name: tert-butyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate. InChIKey: PARGGKARAWEVQO-UHFFFAOYSA-N.
| Molecular formula | C20H32BNO4 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
| InChIKey | PARGGKARAWEVQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCN(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)