cas: 1089279-63-9 — see every product listed under this CAS number, including other names
4-[4-[4-(2-Fluoroethyl)-1-piperazinyl]-1-piperidinyl]-2-(methyloxy)aniline, 97%, 97% (CAS 1089279-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JO45-100mg |
| cas | 1089279-63-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1014.80 Pln | |
| Chemat | 1g | 2114.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline (CAS 1089279-63-9) is a chemical compound with the molecular formula C18H29FN4O and a molecular weight of 336.4 g/mol. IUPAC name: 4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline. InChIKey: HXJLMYXPDIHNFA-UHFFFAOYSA-N.
| Molecular formula | C18H29FN4O |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-[4-[4-(2-fluoroethyl)piperazin-1-yl]piperidin-1-yl]-2-methoxyaniline |
| InChIKey | HXJLMYXPDIHNFA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCC(CC2)N3CCN(CC3)CCF)N |
Computed by PubChem (NCBI)