4-[Bis(4-Fluorophenyl)methylene]piperidine hydrobromide, 95%
cas: 111627-29-3 — see every product listed under this CAS number, including other names
4-[Bis(4-Fluorophenyl)methylene]piperidine hydrobromide, 95% (CAS 111627-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A198683-100mg |
| cas | 111627-29-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1861.13 Pln | |
| Ambeed | 5g | 7234.50 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1701.20 Pln | |
| Chemat | 5g | 6606.80 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 714.22 Pln | |
| BLDpharm | 1g | 1824.94 Pln | |
| BLDpharm | 5g | 7084.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[bis(4-fluorophenyl)methylidene]piperidine;hydrobromide (CAS 111627-29-3) is a chemical compound with the molecular formula C18H18BrF2N and a molecular weight of 366.2 g/mol. IUPAC name: 4-[bis(4-fluorophenyl)methylidene]piperidine;hydrobromide. InChIKey: QYGTZLORLCADEX-UHFFFAOYSA-N.
| Molecular formula | C18H18BrF2N |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | 4-[bis(4-fluorophenyl)methylidene]piperidine;hydrobromide |
| InChIKey | QYGTZLORLCADEX-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F.Br |
Computed by PubChem (NCBI)
Synonyms:
4-[Bis(4-Fluorophenyl)methylene]piperidine hydrobromide, 4-[Bis(4-Fluorophenyl)methylene]-piperidine hydrobromide, 4-[bis(4-fluorophenyl)methylidene]piperidine;hydrobromide, 4-(Bis(4-fluorophenyl)methylene)piperidine hydrobromide, C18H18BrF2N, QYGTZLORLCADEX-UHFFFAOYSA-N, 4-[bis(4-fluorophenyl)methylidene]piperidine,hydrobromide, 4-[bis(4-fluorophenyl)methylene]piperidine;hydrobromide, 4-[Bis(4-fluorophenyl)methylidene]piperidine--hydrogen bromide (1/1)