cas: 364794-85-4 — see every product listed under this CAS number, including other names
4-{[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thien-2-yl]methyl}morpholine, 97% (CAS 364794-85-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC74239CB |
| cas | 364794-85-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 549.81 Pln | |
| Thermo Scientific | 1g | 1114.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine (CAS 364794-85-4) is a chemical compound with the molecular formula C15H24BNO3S and a molecular weight of 309.2 g/mol. IUPAC name: 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine. InChIKey: AMUMGAXTCHBNPU-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3S |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine |
| InChIKey | AMUMGAXTCHBNPU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)CN3CCOCC3 |
Computed by PubChem (NCBI)