cas: 690636-28-3 — see every product listed under this CAS number, including other names
4-{2-[4-(4,4,5,5-Tetramethyl[1,3,2]dioxaborolan-2-yl) phenoxy]ethyl}morpholine, 97% (CAS 690636-28-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065566-1G |
| cas | 690636-28-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 732.05 Pln | |
| Fluorochem | 25g | 3444.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine (CAS 690636-28-3) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine. InChIKey: ZHMKOJLQGMTKKB-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine |
| InChIKey | ZHMKOJLQGMTKKB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCN3CCOCC3 |
Computed by PubChem (NCBI)