4-Acetylpyridine 1-oxide, 98%
cas: 2402-96-2 — see every product listed under this CAS number, including other names
4-Acetylpyridine 1-oxide, 98% (CAS 2402-96-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A109426-250mg |
| cas | 2402-96-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1388.31 Pln | |
| Ambeed | 10g | 2189.31 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 508.73 Pln | |
| BLDpharm | 5g | 1363.99 Pln | |
| BLDpharm | 10g | 2147.05 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 750.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(1-oxidopyridin-1-ium-4-yl)ethanone (CAS 2402-96-2) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. IUPAC name: 1-(1-oxidopyridin-1-ium-4-yl)ethanone. InChIKey: GUHDDRZAZNIQJB-UHFFFAOYSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 137.14 g/mol |
| IUPAC name | 1-(1-oxidopyridin-1-ium-4-yl)ethanone |
| InChIKey | GUHDDRZAZNIQJB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)