cas: 885518-39-8 — see every product listed under this CAS number, including other names
4-Amino-1H-indole-6-carbonitrile, 98% (CAS 885518-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243805-100MG |
| cas | 885518-39-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 784.12 Pln | |
| Fluorochem | 5g | 3689.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-amino-1H-indole-6-carbonitrile (CAS 885518-39-8) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 4-amino-1H-indole-6-carbonitrile. InChIKey: ALWCMYAKSPSBAN-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 4-amino-1H-indole-6-carbonitrile |
| InChIKey | ALWCMYAKSPSBAN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=CC(=C21)N)C#N |
Computed by PubChem (NCBI)