4-Amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol xhydrochloride, 95%
cas: 85236-52-8 — see every product listed under this CAS number, including other names
4-Amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol xhydrochloride, 95% (CAS 85236-52-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2146522-250mg |
| cas | 85236-52-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1571.88 Pln | |
| Ambeed | 25g | 5332.12 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1139.60 Pln | |
| Chemat | 25g | 3827.60 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 508.73 Pln | |
| BLDpharm | 5g | 1541.70 Pln | |
| BLDpharm | 25g | 5229.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol;hydrochloride (CAS 85236-52-8) is a chemical compound with the molecular formula C16H26ClN3O and a molecular weight of 311.8 g/mol. IUPAC name: 4-amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol;hydrochloride. InChIKey: OKJGXEVZKFNUQO-UHFFFAOYSA-N.
| Molecular formula | C16H26ClN3O |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 4-amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol;hydrochloride |
| InChIKey | OKJGXEVZKFNUQO-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CC(=CC(=C2O)CN3CCCC3)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol xhydrochloride, Phenol, 4-amino-2,6-bis(1-pyrrolidinylmethyl)-, hydrochloride, 4-Amino-2,6-bis(pyrrolidin-1-ylmethyl)phenol;hydrochloride, 4-Amino-2,6-bis(1-pyrrolidinylmethyl)phenol Hydrochloride, 4-Amino-2,6-bis[(pyrrolidin-1-yl)methyl]phenol--hydrogen chloride (1/1)