cas: 5453-06-5 — see every product listed under this CAS number, including other names
4-Amino-2-chloro-6-methyl-5-nitropyrimidine 97% (CAS 5453-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172396-100mg |
| cas | 5453-06-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 2005.75 Pln | |
| Ambeed | 10g | 3941.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A172396 |
2-chloro-6-methyl-5-nitropyrimidin-4-amine (CAS 5453-06-5) is a chemical compound with the molecular formula C5H5ClN4O2 and a molecular weight of 188.57 g/mol. IUPAC name: 2-chloro-6-methyl-5-nitropyrimidin-4-amine. InChIKey: ZBYYVBFAHVINCE-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN4O2 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-chloro-6-methyl-5-nitropyrimidin-4-amine |
| InChIKey | ZBYYVBFAHVINCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)