cas: 31793-29-0 — see every product listed under this CAS number, including other names
4-Amino-3,5-dinitropyridine, 98% (CAS 31793-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077669-250MG |
| cas | 31793-29-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 10g | 331.15 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 653.95 Pln | |
| Fluorochem | 100g | 1997.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dinitropyridin-4-amine (CAS 31793-29-0) is a chemical compound with the molecular formula C5H4N4O4 and a molecular weight of 184.11 g/mol. IUPAC name: 3,5-dinitropyridin-4-amine. InChIKey: IEUQRKITTGSLJL-UHFFFAOYSA-N.
| Molecular formula | C5H4N4O4 |
|---|---|
| Molecular weight | 184.11 g/mol |
| IUPAC name | 3,5-dinitropyridin-4-amine |
| InChIKey | IEUQRKITTGSLJL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)[N+](=O)[O-])N)[N+](=O)[O-] |
Computed by PubChem (NCBI)