cas: 39150-45-3 — see every product listed under this CAS number, including other names
4-Amino-3,5-dibromobenzenesulfonamide, 96%, 96% (CAS 39150-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9JQ-1g |
| cas | 39150-45-3 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 789.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-amino-3,5-dibromobenzenesulfonamide (CAS 39150-45-3) is a chemical compound with the molecular formula C6H6Br2N2O2S and a molecular weight of 330.00 g/mol. IUPAC name: 4-amino-3,5-dibromobenzenesulfonamide. InChIKey: DLXJPWSYRLLYSV-UHFFFAOYSA-N.
| Molecular formula | C6H6Br2N2O2S |
|---|---|
| Molecular weight | 330.00 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzenesulfonamide |
| InChIKey | DLXJPWSYRLLYSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)