Products 2386388-03-8
CAS 2386388-03-8 appears in our catalog under these names: 4-Amino-6-chloro-2-methylnicotinic acid, 95%, 95%, 4-Amino-6-chloro-2-methylnicotinic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-amino-6-chloro-2-methylpyridine-3-carboxylic acid (CAS 2386388-03-8) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 4-amino-6-chloro-2-methylpyridine-3-carboxylic acid. InChIKey: RRJHJERXTCJAGB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-amino-6-chloro-2-methylpyridine-3-carboxylic acid |
| InChIKey | RRJHJERXTCJAGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=N1)Cl)N)C(=O)O |
Computed by PubChem (NCBI)