cas: 1709-54-2 — see every product listed under this CAS number, including other names
4-Amino-N-benzylbenzenesulfonamide, ≥98%, ≥98% (CAS 1709-54-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQ2D-50mg |
| cas | 1709-54-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 1053.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
4-amino-N-benzylbenzenesulfonamide (CAS 1709-54-2) is a chemical compound with the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. IUPAC name: 4-amino-N-benzylbenzenesulfonamide. InChIKey: ZHKXBELKPQXYEH-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 4-amino-N-benzylbenzenesulfonamide |
| InChIKey | ZHKXBELKPQXYEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)