cas: 640735-24-6 — see every product listed under this CAS number, including other names
4-BROMO-1-(TRIISOPROPYLSILYL)-7-AZAINDOLE, 98% (CAS 640735-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F467370-100MG |
| cas | 640735-24-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 305.12 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 500mg | 544.62 Pln | |
| Fluorochem | 1g | 711.23 Pln | |
| Fluorochem | 5g | 2054.50 Pln | |
| Fluorochem | 10g | 3746.62 Pln | |
| Fluorochem | 25g | 9104.10 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1379.60 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-bromopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 640735-24-6) is a chemical compound with the molecular formula C16H25BrN2Si and a molecular weight of 353.37 g/mol. IUPAC name: (4-bromopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: QSEMMUYKUYKNBI-UHFFFAOYSA-N.
| Molecular formula | C16H25BrN2Si |
|---|---|
| Molecular weight | 353.37 g/mol |
| IUPAC name | (4-bromopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | QSEMMUYKUYKNBI-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C=CN=C21)Br |
Computed by PubChem (NCBI)