cas: 3084-04-6 — see every product listed under this CAS number, including other names
4-Benzofuran-2-yl-thiazol-2-ylamine, 98% (CAS 3084-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F495491-100MG |
| cas | 3084-04-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 500mg | 935.11 Pln | |
| Fluorochem | 1g | 1257.91 Pln | |
| Fluorochem | 2.5g | 2330.45 Pln | |
| Fluorochem | 5g | 3038.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(1-benzofuran-2-yl)-1,3-thiazol-2-amine (CAS 3084-04-6) is a chemical compound with the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. IUPAC name: 4-(1-benzofuran-2-yl)-1,3-thiazol-2-amine. InChIKey: IQIAVCUUQIGJPO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2OS |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 4-(1-benzofuran-2-yl)-1,3-thiazol-2-amine |
| InChIKey | IQIAVCUUQIGJPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)