cas: 850568-52-4 — see every product listed under this CAS number, including other names
4-Benzyloxy-1-tert-butoxycarbonylindole-2-boronic acid, 97% (CAS 850568-52-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F016100-1G |
| cas | 850568-52-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1362.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylmethoxyindol-2-yl]boronic acid (CAS 850568-52-4) is a chemical compound with the molecular formula C20H22BNO5 and a molecular weight of 367.2 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylmethoxyindol-2-yl]boronic acid. InChIKey: YXJBIADEQVCONT-UHFFFAOYSA-N.
| Molecular formula | C20H22BNO5 |
|---|---|
| Molecular weight | 367.2 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylmethoxyindol-2-yl]boronic acid |
| InChIKey | YXJBIADEQVCONT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=C2OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)