cas: 1073354-22-9 — see every product listed under this CAS number, including other names
4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester, ≥95%, ≥95% (CAS 1073354-22-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K71-1g |
| cas | 1073354-22-9 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2286.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1073354-22-9) is a chemical compound with the molecular formula C17H20BClN2O3 and a molecular weight of 346.6 g/mol. IUPAC name: 2-chloro-4-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: YXXPVSCUVOPQBT-UHFFFAOYSA-N.
| Molecular formula | C17H20BClN2O3 |
|---|---|
| Molecular weight | 346.6 g/mol |
| IUPAC name | 2-chloro-4-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | YXXPVSCUVOPQBT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2OCC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)