cas: 13754-41-1 — see every product listed under this CAS number, including other names
4-Benzylpiperazin-2-one, 98%, 98% (CAS 13754-41-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124JD-250mg |
| cas | 13754-41-1 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 731.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-benzylpiperazin-2-one (CAS 13754-41-1) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 4-benzylpiperazin-2-one. InChIKey: SBWVHKNCFZRBRJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 4-benzylpiperazin-2-one |
| InChIKey | SBWVHKNCFZRBRJ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)