4-Boc-2,3-Hihydro-1,4-Benzoxazine-6-Boronic Acid, 96%, 96%
cas: 2096340-12-2 — see every product listed under this CAS number, including other names
4-Boc-2,3-Hihydro-1,4-Benzoxazine-6-Boronic Acid, 96%, 96% (CAS 2096340-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DKY8-100mg |
| cas | 2096340-12-2 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 1792.40 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]boronic acid (CAS 2096340-12-2) is a chemical compound with the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]boronic acid. InChIKey: TWQCRBQJOUVYBQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO5 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]boronic acid |
| InChIKey | TWQCRBQJOUVYBQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCN2C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(tert-Butoxycarbonyl)-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronic acid, 4-BOC-2,3-Hihydro-1,4-benzoxazine-6-boronic acid, 4-BOC-2,3-Dihydro-1,4-benzoxazine-6-boronic acid, 4-Boc-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-boronic Acid, (4-tert-butoxycarbonyl-2,3-dihydro-1,4-benzoxazin-6-yl)boronic acid, (4-(tert-Butoxycarbonyl)-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronicacid