4-Borono-3-ethoxy-5-fluorobenzoic acid, 98%
cas: 1620678-09-2 — see every product listed under this CAS number, including other names
4-Borono-3-ethoxy-5-fluorobenzoic acid, 98% (CAS 1620678-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1942532-100mg |
| cas | 1620678-09-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1916.75 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 747.54 Pln | |
| BLDpharm | 1g | 1880.47 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-borono-3-ethoxy-5-fluorobenzoic acid (CAS 1620678-09-2) is a chemical compound with the molecular formula C9H10BFO5 and a molecular weight of 227.98 g/mol. IUPAC name: 4-borono-3-ethoxy-5-fluorobenzoic acid. InChIKey: FKACDFOMKMLODP-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO5 |
|---|---|
| Molecular weight | 227.98 g/mol |
| IUPAC name | 4-borono-3-ethoxy-5-fluorobenzoic acid |
| InChIKey | FKACDFOMKMLODP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)O)OCC)(O)O |
Computed by PubChem (NCBI)