cas: 175278-12-3 — see every product listed under this CAS number, including other names
4-Bromo-2-(trifluoromethoxy)iodobenzene 98% (CAS 175278-12-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A935763-5g |
| cas | 175278-12-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 2139.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A935763 |
4-bromo-1-iodo-2-(trifluoromethoxy)benzene (CAS 175278-12-3) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 4-bromo-1-iodo-2-(trifluoromethoxy)benzene. InChIKey: IGWVTCXEZVURNB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 4-bromo-1-iodo-2-(trifluoromethoxy)benzene |
| InChIKey | IGWVTCXEZVURNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)I |
Computed by PubChem (NCBI)