cas: 158579-80-7 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-1-(trifluoromethoxy)benzene, 98%, 98% (CAS 158579-80-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QB2-250mg |
| cas | 158579-80-7 |
| size | 250mg |
| availability | 101.38g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 1192.40 Pln | |
| Chemat | 50g | 630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-chloro-1-(trifluoromethoxy)benzene (CAS 158579-80-7) is a chemical compound with the molecular formula C7H3BrClF3O and a molecular weight of 275.45 g/mol. IUPAC name: 4-bromo-2-chloro-1-(trifluoromethoxy)benzene. InChIKey: WSENYRJAJFHXQR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O |
|---|---|
| Molecular weight | 275.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-1-(trifluoromethoxy)benzene |
| InChIKey | WSENYRJAJFHXQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)