cas: 2121513-32-2 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-6-methoxyphenylboronic acid pinacol ester, 97% (CAS 2121513-32-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627611-250MG |
| cas | 2121513-32-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 4381.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromo-2-fluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-32-2) is a chemical compound with the molecular formula C13H17BBrFO3 and a molecular weight of 330.99 g/mol. IUPAC name: 2-(4-bromo-2-fluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FYAGPFGNJZMYFT-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO3 |
|---|---|
| Molecular weight | 330.99 g/mol |
| IUPAC name | 2-(4-bromo-2-fluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FYAGPFGNJZMYFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)Br)OC |
Computed by PubChem (NCBI)