cas: 74266-66-3 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-6-nitroanisole 98% (CAS 74266-66-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A542316-1g |
| cas | 74266-66-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 587.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A542316 |
5-bromo-1-fluoro-2-methoxy-3-nitrobenzene (CAS 74266-66-3) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 5-bromo-1-fluoro-2-methoxy-3-nitrobenzene. InChIKey: CVCAYLYLJKBSNV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 5-bromo-1-fluoro-2-methoxy-3-nitrobenzene |
| InChIKey | CVCAYLYLJKBSNV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)