cas: 262433-01-2 — see every product listed under this CAS number, including other names
4-Bromo-2-methoxy-N-Boc-aniline, 98% (CAS 262433-01-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011584-1G |
| cas | 262433-01-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 659.16 Pln | |
| Fluorochem | 25g | 716.43 Pln | |
| Fluorochem | 100g | 2262.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-bromo-2-methoxyphenyl)carbamate (CAS 262433-01-2) is a chemical compound with the molecular formula C12H16BrNO3 and a molecular weight of 302.16 g/mol. IUPAC name: tert-butyl N-(4-bromo-2-methoxyphenyl)carbamate. InChIKey: LFWHJZGNFWTUIO-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO3 |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2-methoxyphenyl)carbamate |
| InChIKey | LFWHJZGNFWTUIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)OC |
Computed by PubChem (NCBI)