cas: 1255574-47-0 — see every product listed under this CAS number, including other names
4-Bromo-2-nitro-5-(octyloxy)aniline, 95% (CAS 1255574-47-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A226848-25g |
| cas | 1255574-47-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 3878.35 Pln | |
| Fluorochem | 1g | 2122.19 Pln | |
| Fluorochem | 5g | 7307.86 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-nitro-5-octoxyaniline (CAS 1255574-47-0) is a chemical compound with the molecular formula C14H21BrN2O3 and a molecular weight of 345.23 g/mol. IUPAC name: 4-bromo-2-nitro-5-octoxyaniline. InChIKey: XPZPTCBPSUTRHV-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O3 |
|---|---|
| Molecular weight | 345.23 g/mol |
| IUPAC name | 4-bromo-2-nitro-5-octoxyaniline |
| InChIKey | XPZPTCBPSUTRHV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=C(C=C(C(=C1)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)