CAS 864825-81-0 appears in our catalog under these names: 4-Bromo-3,5-dimethyl-benzamide, 95%, 4-Bromo-3,5-dimethyl-benzamide 97%, 4-bromo-3,5-dimethylbenzamide, 97%, 97%, 4-Bromo-3,5-dimethyl-benzamide, ≥97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100g, 25g.
4-bromo-3,5-dimethylbenzamide (CAS 864825-81-0) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 4-bromo-3,5-dimethylbenzamide. InChIKey: ATWMWAQQPBRPCA-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 4-bromo-3,5-dimethylbenzamide |
| InChIKey | ATWMWAQQPBRPCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C(=O)N |
Computed by PubChem (NCBI)