cas: 879487-75-9 — see every product listed under this CAS number, including other names
4-Bromo-3-methylbenzenesulfonamide, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 879487-75-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115EF7-250mg |
| cas | 879487-75-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 2157.20 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-methylbenzenesulfonamide (CAS 879487-75-9) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: 4-bromo-3-methylbenzenesulfonamide. InChIKey: KRUSKWRPOCHSGC-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 4-bromo-3-methylbenzenesulfonamide |
| InChIKey | KRUSKWRPOCHSGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)N)Br |
Computed by PubChem (NCBI)