CAS 74386-13-3 appears in our catalog under these names: 4–Bromo–3–nitrophenylboronic acid, 4-Bromo-3-nitrophenylboronic acid, 97%, 4-Bromo-3-nitrophenylboronic acid, ≥95%, 4-Bromo-3-nitrophenylboronic acid, 97%, 97%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
(4-bromo-3-nitrophenyl)boronic acid (CAS 74386-13-3) is a chemical compound with the molecular formula C6H5BBrNO4 and a molecular weight of 245.83 g/mol. IUPAC name: (4-bromo-3-nitrophenyl)boronic acid. InChIKey: ACFLUOVNZOLXAZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrNO4 |
|---|---|
| Molecular weight | 245.83 g/mol |
| IUPAC name | (4-bromo-3-nitrophenyl)boronic acid |
| InChIKey | ACFLUOVNZOLXAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)