cas: 117692-99-6 — see every product listed under this CAS number, including other names
4-Bromo-4'-(phenylmethoxy)-1,1'-biphenyl, 95%, 95% (CAS 117692-99-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119ZH3-100mg |
| cas | 117692-99-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1341.20 Pln | |
| Chemat | 10g | 2234.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-(4-phenylmethoxyphenyl)benzene (CAS 117692-99-6) is a chemical compound with the molecular formula C19H15BrO and a molecular weight of 339.2 g/mol. IUPAC name: 1-bromo-4-(4-phenylmethoxyphenyl)benzene. InChIKey: IOAHVBDYCWBWAR-UHFFFAOYSA-N.
| Molecular formula | C19H15BrO |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 1-bromo-4-(4-phenylmethoxyphenyl)benzene |
| InChIKey | IOAHVBDYCWBWAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)