cas: 65001-78-7 — see every product listed under this CAS number, including other names
4-Bromo-5-chloro-2-nitrophenol, 95%, 95% (CAS 65001-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELWM-100mg |
| cas | 65001-78-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1634.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-5-chloro-2-nitrophenol (CAS 65001-78-7) is a chemical compound with the molecular formula C6H3BrClNO3 and a molecular weight of 252.45 g/mol. IUPAC name: 4-bromo-5-chloro-2-nitrophenol. InChIKey: FDHXSXGNKTYRRU-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO3 |
|---|---|
| Molecular weight | 252.45 g/mol |
| IUPAC name | 4-bromo-5-chloro-2-nitrophenol |
| InChIKey | FDHXSXGNKTYRRU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)