cas: 2368909-42-4 — see every product listed under this CAS number, including other names
4-Bromo-5-chloro-6-methyl-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole, 97% (CAS 2368909-42-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1374982-10g |
| cas | 2368909-42-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 24033.31 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 5474.00 Pln | |
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 1g | 1122.54 Pln | |
| Fluorochem | 5g | 3293.65 Pln | |
| Fluorochem | 10g | 5230.47 Pln | |
| Fluorochem | 25g | 9978.80 Pln | |
| Fluorochem | 250mg | 981.96 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-5-chloro-6-methyl-1-(oxan-2-yl)indazole (CAS 2368909-42-4) is a chemical compound with the molecular formula C13H14BrClN2O and a molecular weight of 329.62 g/mol. IUPAC name: 4-bromo-5-chloro-6-methyl-1-(oxan-2-yl)indazole. InChIKey: NHJXVSLVWFNANE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrClN2O |
|---|---|
| Molecular weight | 329.62 g/mol |
| IUPAC name | 4-bromo-5-chloro-6-methyl-1-(oxan-2-yl)indazole |
| InChIKey | NHJXVSLVWFNANE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=NN2C3CCCCO3)C(=C1Cl)Br |
Computed by PubChem (NCBI)