cas: 6963-65-1 — see every product listed under this CAS number, including other names
4-Bromo-5-nitroimidazole 97% (CAS 6963-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A283893-250mg |
| cas | 6963-65-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 25g | 1666.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A283893 |
4-bromo-5-nitro-1H-imidazole (CAS 6963-65-1) is a chemical compound with the molecular formula C3H2BrN3O2 and a molecular weight of 191.97 g/mol. IUPAC name: 4-bromo-5-nitro-1H-imidazole. InChIKey: KSEFBYAEHWXHLM-UHFFFAOYSA-N.
| Molecular formula | C3H2BrN3O2 |
|---|---|
| Molecular weight | 191.97 g/mol |
| IUPAC name | 4-bromo-5-nitro-1H-imidazole |
| InChIKey | KSEFBYAEHWXHLM-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)