4-Bromo-6-chloro-8-methylquinoline, 98%
cas: 927800-42-8 — see every product listed under this CAS number, including other names
4-Bromo-6-chloro-8-methylquinoline, 98% (CAS 927800-42-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A600066-100mg |
| cas | 927800-42-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1304.88 Pln | |
| Ambeed | 5g | 6188.75 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 933.20 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1397.31 Pln | |
| BLDpharm | 5g | 6667.68 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1054.85 Pln | |
| Fluorochem | 5g | 4944.11 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-bromo-6-chloro-8-methylquinoline (CAS 927800-42-8) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 4-bromo-6-chloro-8-methylquinoline. InChIKey: YREAKKJLXOJDOW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 4-bromo-6-chloro-8-methylquinoline |
| InChIKey | YREAKKJLXOJDOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C(C=CN=C12)Br)Cl |
Computed by PubChem (NCBI)